C31H29NO5 — CID 10767544
(2S)-2-(2-benzoylanilino)-3-[4-(2-phenylmethoxyethoxy)phenyl]propanoic acid (PubChem CID 10767544) has the molecular formula C31H29NO5 and a molecular weight of 495.58 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-(2-phenylmethoxyethoxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-(2-phenylmethoxyethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 10767544 |
| Molecular Formula | C31H29NO5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-(2-phenylmethoxyethoxy)phenyl]propanoic acid |
| SMILES | O=C(c1ccccc1)c1ccccc1N[C@@H](Cc1ccc(OCCOCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C31H29NO5/c33-30(25-11-5-2-6-12-25)27-13-7-8-14-28(27)32-29(31(34)35)21-23-15-17-26(18-16-23)37-20-19-36-22-24-9-3-1-4-10-24/h1-18,29,32H,19-22H2,(H,34,35)/t29-/m0/s1 |
| InChIKey | ZVHJINDKBGIFQQ-LJAQVGFWSA-N |
| XLogP | 5.62 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|