C38H42N2O5 — CID 69128007
(2S)-2-(2-benzoylanilino)-3-[4-[2-(8-phenyloctanoylamino)ethoxy]phenyl]propanoic acid (PubChem CID 69128007) has the molecular formula C38H42N2O5 and a molecular weight of 606.76 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[2-(8-phenyloctanoylamino)ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-(8-phenyloctanoylamino)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69128007 |
| Molecular Formula | C38H42N2O5 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-(8-phenyloctanoylamino)ethoxy]phenyl]propanoic acid |
| SMILES | O=C(CCCCCCCc1ccccc1)NCCOc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C38H42N2O5/c41-36(21-11-3-1-2-6-14-29-15-7-4-8-16-29)39-26-27-45-32-24-22-30(23-25-32)28-35(38(43)44)40-34-20-13-12-19-33(34)37(42)31-17-9-5-10-18-31/h4-5,7-10,12-13,15-20,22-25,35,40H,1-3,6,11,14,21,26-28H2,(H,39,41)(H,43,44)/t35-/m0/s1 |
| InChIKey | CKQFTRAIRROQMV-DHUJRADRSA-N |
| XLogP | 7.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|