C37H39FN2O5 — CID 69126571
methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[5-(2-fluorophenyl)pentanoylamino]propoxy]phenyl]propanoate (PubChem CID 69126571) has the molecular formula C37H39FN2O5 and a molecular weight of 610.73 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[5-(2-fluorophenyl)pentanoylamino]propoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[5-(2-fluorophenyl)pentanoylamino]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69126571 |
| Molecular Formula | C37H39FN2O5 |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[5-(2-fluorophenyl)pentanoylamino]propoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCCNC(=O)CCCCc2ccccc2F)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C37H39FN2O5/c1-44-37(43)34(40-33-18-9-7-16-31(33)36(42)29-14-3-2-4-15-29)26-27-20-22-30(23-21-27)45-25-11-24-39-35(41)19-10-6-13-28-12-5-8-17-32(28)38/h2-5,7-9,12,14-18,20-23,34,40H,6,10-11,13,19,24-26H2,1H3,(H,39,41)/t34-/m0/s1 |
| InChIKey | NKVJTYFEIOFIBC-UMSFTDKQSA-N |
| XLogP | 6.55 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|