C34H33FN2O5 — CID 69127503
(2S)-2-(2-benzoylanilino)-3-[4-[3-[3-(2-fluorophenyl)propanoylamino]propoxy]phenyl]propanoic acid (PubChem CID 69127503) has the molecular formula C34H33FN2O5 and a molecular weight of 568.65 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[3-[3-(2-fluorophenyl)propanoylamino]propoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[3-(2-fluorophenyl)propanoylamino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127503 |
| Molecular Formula | C34H33FN2O5 |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[3-(2-fluorophenyl)propanoylamino]propoxy]phenyl]propanoic acid |
| SMILES | O=C(CCc1ccccc1F)NCCCOc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C34H33FN2O5/c35-29-13-6-4-9-25(29)17-20-32(38)36-21-8-22-42-27-18-15-24(16-19-27)23-31(34(40)41)37-30-14-7-5-12-28(30)33(39)26-10-2-1-3-11-26/h1-7,9-16,18-19,31,37H,8,17,20-23H2,(H,36,38)(H,40,41)/t31-/m0/s1 |
| InChIKey | LGEZFQNAFZXKHC-HKBQPEDESA-N |
| XLogP | 5.68 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|