C38H40N2O5 — CID 69127578
2-(2-benzoylanilino)-3-[4-[3-[(1-benzylcyclopentanecarbonyl)amino]propoxy]phenyl]propanoic acid (PubChem CID 69127578) has the molecular formula C38H40N2O5 and a molecular weight of 604.75 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[3-[(1-benzylcyclopentanecarbonyl)amino]propoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[3-[(1-benzylcyclopentanecarbonyl)amino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127578 |
| Molecular Formula | C38H40N2O5 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[3-[(1-benzylcyclopentanecarbonyl)amino]propoxy]phenyl]propanoic acid |
| SMILES | O=C(c1ccccc1)c1ccccc1NC(Cc1ccc(OCCCNC(=O)C2(Cc3ccccc3)CCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C38H40N2O5/c41-35(30-14-5-2-6-15-30)32-16-7-8-17-33(32)40-34(36(42)43)26-28-18-20-31(21-19-28)45-25-11-24-39-37(44)38(22-9-10-23-38)27-29-12-3-1-4-13-29/h1-8,12-21,34,40H,9-11,22-27H2,(H,39,44)(H,42,43) |
| InChIKey | HTPUNBPHEOGBJQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|