C39H42N2O5 — CID 69126611
methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[(1-benzylcyclopentanecarbonyl)amino]propoxy]phenyl]propanoate (PubChem CID 69126611) has the molecular formula C39H42N2O5 and a molecular weight of 618.77 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[(1-benzylcyclopentanecarbonyl)amino]propoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[(1-benzylcyclopentanecarbonyl)amino]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69126611 |
| Molecular Formula | C39H42N2O5 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[(1-benzylcyclopentanecarbonyl)amino]propoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCCNC(=O)C2(Cc3ccccc3)CCCC2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C39H42N2O5/c1-45-37(43)35(41-34-18-9-8-17-33(34)36(42)31-15-6-3-7-16-31)27-29-19-21-32(22-20-29)46-26-12-25-40-38(44)39(23-10-11-24-39)28-30-13-4-2-5-14-30/h2-9,13-22,35,41H,10-12,23-28H2,1H3,(H,40,44)/t35-/m0/s1 |
| InChIKey | FVYHIDNBOHCBCP-DHUJRADRSA-N |
| XLogP | 6.80 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|