C35H42N2O5 — CID 69126137
methyl 2-(2-benzoylanilino)-3-[4-[2-[(1-butanoylcyclohexyl)amino]ethoxy]phenyl]propanoate (PubChem CID 69126137) has the molecular formula C35H42N2O5 and a molecular weight of 570.73 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[2-[(1-butanoylcyclohexyl)amino]ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[2-[(1-butanoylcyclohexyl)amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69126137 |
| Molecular Formula | C35H42N2O5 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[2-[(1-butanoylcyclohexyl)amino]ethoxy]phenyl]propanoate |
| SMILES | CCCC(=O)C1(NCCOc2ccc(CC(Nc3ccccc3C(=O)c3ccccc3)C(=O)OC)cc2)CCCCC1 |
| InChI | InChI=1S/C35H42N2O5/c1-3-12-32(38)35(21-10-5-11-22-35)36-23-24-42-28-19-17-26(18-20-28)25-31(34(40)41-2)37-30-16-9-8-15-29(30)33(39)27-13-6-4-7-14-27/h4,6-9,13-20,31,36-37H,3,5,10-12,21-25H2,1-2H3 |
| InChIKey | PKGUIDYPZIMMRA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|