C33H38N2O5 — CID 69127682
2-(2-benzoylanilino)-3-[4-[3-[(1-butanoylcyclopropyl)methylamino]propoxy]phenyl]propanoic acid (PubChem CID 69127682) has the molecular formula C33H38N2O5 and a molecular weight of 542.68 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[3-[(1-butanoylcyclopropyl)methylamino]propoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[3-[(1-butanoylcyclopropyl)methylamino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127682 |
| Molecular Formula | C33H38N2O5 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[3-[(1-butanoylcyclopropyl)methylamino]propoxy]phenyl]propanoic acid |
| SMILES | CCCC(=O)C1(CNCCCOc2ccc(CC(Nc3ccccc3C(=O)c3ccccc3)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C33H38N2O5/c1-2-9-30(36)33(18-19-33)23-34-20-8-21-40-26-16-14-24(15-17-26)22-29(32(38)39)35-28-13-7-6-12-27(28)31(37)25-10-4-3-5-11-25/h3-7,10-17,29,34-35H,2,8-9,18-23H2,1H3,(H,38,39) |
| InChIKey | XBLWEPKUCFYHIX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|