C31H36N2O5 — CID 69126794
(2S)-2-(2-benzoylanilino)-3-[4-[2-[(5-methyl-4-oxohexyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 69126794) has the molecular formula C31H36N2O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[2-[(5-methyl-4-oxohexyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[(5-methyl-4-oxohexyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69126794 |
| Molecular Formula | C31H36N2O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[(5-methyl-4-oxohexyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CC(C)C(=O)CCCNCCOc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C31H36N2O5/c1-22(2)29(34)13-8-18-32-19-20-38-25-16-14-23(15-17-25)21-28(31(36)37)33-27-12-7-6-11-26(27)30(35)24-9-4-3-5-10-24/h3-7,9-12,14-17,22,28,32-33H,8,13,18-21H2,1-2H3,(H,36,37)/t28-/m0/s1 |
| InChIKey | IZHXLSQFIPYDDM-NDEPHWFRSA-N |
| XLogP | 5.00 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|