C35H35ClN2O5 — CID 91578544
methyl 2-(2-benzoylanilino)-3-[4-[3-[[3-(3-chlorophenyl)-3-oxopropyl]amino]propoxy]phenyl]propanoate (PubChem CID 91578544) has the molecular formula C35H35ClN2O5 and a molecular weight of 599.13 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[3-[[3-(3-chlorophenyl)-3-oxopropyl]amino]propoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[3-[[3-(3-chlorophenyl)-3-oxopropyl]amino]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 91578544 |
| Molecular Formula | C35H35ClN2O5 |
| Molecular Weight | 599.13 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[3-[[3-(3-chlorophenyl)-3-oxopropyl]amino]propoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCCNCCC(=O)c2cccc(Cl)c2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H35ClN2O5/c1-42-35(41)32(38-31-14-6-5-13-30(31)34(40)26-9-3-2-4-10-26)23-25-15-17-29(18-16-25)43-22-8-20-37-21-19-33(39)27-11-7-12-28(36)24-27/h2-7,9-18,24,32,37-38H,8,19-23H2,1H3 |
| InChIKey | IIKGPBRVHOEXDT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.13 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|