C37H39ClN2O4 — CID 69127688
methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[[(3-chlorophenyl)-cyclopentylmethyl]amino]ethoxy]phenyl]propanoate (PubChem CID 69127688) has the molecular formula C37H39ClN2O4 and a molecular weight of 611.18 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[[(3-chlorophenyl)-cyclopentylmethyl]amino]ethoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[[(3-chlorophenyl)-cyclopentylmethyl]amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69127688 |
| Molecular Formula | C37H39ClN2O4 |
| Molecular Weight | 611.18 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[[(3-chlorophenyl)-cyclopentylmethyl]amino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCNC(c2cccc(Cl)c2)C2CCCC2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C37H39ClN2O4/c1-43-37(42)34(40-33-17-8-7-16-32(33)36(41)28-12-3-2-4-13-28)24-26-18-20-31(21-19-26)44-23-22-39-35(27-10-5-6-11-27)29-14-9-15-30(38)25-29/h2-4,7-9,12-21,25,27,34-35,39-40H,5-6,10-11,22-24H2,1H3/t34-,35?/m0/s1 |
| InChIKey | DLMGYAJNOVWKEQ-SFCXHYMASA-N |
| XLogP | 7.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.18 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|