C35H40N2O5 — CID 69141737
methyl 2-(2-benzoylanilino)-3-[4-[2-[(2-cyclopentyl-1-cyclopropyl-2-oxoethyl)amino]ethoxy]phenyl]propanoate (PubChem CID 69141737) has the molecular formula C35H40N2O5 and a molecular weight of 568.71 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[2-[(2-cyclopentyl-1-cyclopropyl-2-oxoethyl)amino]ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[2-[(2-cyclopentyl-1-cyclopropyl-2-oxoethyl)amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69141737 |
| Molecular Formula | C35H40N2O5 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[2-[(2-cyclopentyl-1-cyclopropyl-2-oxoethyl)amino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCNC(C(=O)C2CCCC2)C2CC2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H40N2O5/c1-41-35(40)31(37-30-14-8-7-13-29(30)33(38)26-9-3-2-4-10-26)23-24-15-19-28(20-16-24)42-22-21-36-32(25-17-18-25)34(39)27-11-5-6-12-27/h2-4,7-10,13-16,19-20,25,27,31-32,36-37H,5-6,11-12,17-18,21-23H2,1H3 |
| InChIKey | ZBGBHCDFUIUOIQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|