C32H32N2O4 — CID 69128324
methyl 2-(2-benzoylanilino)-3-[4-[2-(benzylamino)ethoxy]phenyl]propanoate (PubChem CID 69128324) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[2-(benzylamino)ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[2-(benzylamino)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69128324 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[2-(benzylamino)ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCNCc2ccccc2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C32H32N2O4/c1-37-32(36)30(34-29-15-9-8-14-28(29)31(35)26-12-6-3-7-13-26)22-24-16-18-27(19-17-24)38-21-20-33-23-25-10-4-2-5-11-25/h2-19,30,33-34H,20-23H2,1H3 |
| InChIKey | OFQOOQKTOVVREW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|