C38H36N2O5 — CID 69127706
methyl 2-(2-benzoylanilino)-3-[4-[2-(2-naphthalen-1-ylpropanoylamino)ethoxy]phenyl]propanoate (PubChem CID 69127706) has the molecular formula C38H36N2O5 and a molecular weight of 600.72 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[2-(2-naphthalen-1-ylpropanoylamino)ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[2-(2-naphthalen-1-ylpropanoylamino)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69127706 |
| Molecular Formula | C38H36N2O5 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[2-(2-naphthalen-1-ylpropanoylamino)ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCNC(=O)C(C)c2cccc3ccccc23)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C38H36N2O5/c1-26(31-17-10-14-28-11-6-7-15-32(28)31)37(42)39-23-24-45-30-21-19-27(20-22-30)25-35(38(43)44-2)40-34-18-9-8-16-33(34)36(41)29-12-4-3-5-13-29/h3-22,26,35,40H,23-25H2,1-2H3,(H,39,42) |
| InChIKey | BBCAWAPJFVPVAJ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|