C36H38N2O5 — CID 69128610
2-(2-benzoylanilino)-3-[4-[3-[(2,2-dimethyl-3-phenylpropanoyl)amino]propoxy]phenyl]propanoic acid (PubChem CID 69128610) has the molecular formula C36H38N2O5 and a molecular weight of 578.71 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[3-[(2,2-dimethyl-3-phenylpropanoyl)amino]propoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[3-[(2,2-dimethyl-3-phenylpropanoyl)amino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69128610 |
| Molecular Formula | C36H38N2O5 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[3-[(2,2-dimethyl-3-phenylpropanoyl)amino]propoxy]phenyl]propanoic acid |
| SMILES | CC(C)(Cc1ccccc1)C(=O)NCCCOc1ccc(CC(Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C36H38N2O5/c1-36(2,25-27-12-5-3-6-13-27)35(42)37-22-11-23-43-29-20-18-26(19-21-29)24-32(34(40)41)38-31-17-10-9-16-30(31)33(39)28-14-7-4-8-15-28/h3-10,12-21,32,38H,11,22-25H2,1-2H3,(H,37,42)(H,40,41) |
| InChIKey | RCVZBMLTPTUHBC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|