C32H36N2O5 — CID 69127832
2-(2-benzoylanilino)-3-[4-[2-[(3-cyclopropyl-2,2-dimethylpropanoyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 69127832) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[2-[(3-cyclopropyl-2,2-dimethylpropanoyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[2-[(3-cyclopropyl-2,2-dimethylpropanoyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127832 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[2-[(3-cyclopropyl-2,2-dimethylpropanoyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CC(C)(CC1CC1)C(=O)NCCOc1ccc(CC(Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C32H36N2O5/c1-32(2,21-23-12-13-23)31(38)33-18-19-39-25-16-14-22(15-17-25)20-28(30(36)37)34-27-11-7-6-10-26(27)29(35)24-8-4-3-5-9-24/h3-11,14-17,23,28,34H,12-13,18-21H2,1-2H3,(H,33,38)(H,36,37) |
| InChIKey | PJWQHNJQVBXPMV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|