C33H38N2O6 — CID 174523043
2-(2-benzoyloxyanilino)-3-[4-[3-[(3-cyclopropyl-2,2-dimethylpropanoyl)amino]propoxy]phenyl]propanoic acid (PubChem CID 174523043) has the molecular formula C33H38N2O6 and a molecular weight of 558.68 g/mol. Its IUPAC name is 2-(2-benzoyloxyanilino)-3-[4-[3-[(3-cyclopropyl-2,2-dimethylpropanoyl)amino]propoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoyloxyanilino)-3-[4-[3-[(3-cyclopropyl-2,2-dimethylpropanoyl)amino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 174523043 |
| Molecular Formula | C33H38N2O6 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | 2-(2-benzoyloxyanilino)-3-[4-[3-[(3-cyclopropyl-2,2-dimethylpropanoyl)amino]propoxy]phenyl]propanoic acid |
| SMILES | CC(C)(CC1CC1)C(=O)NCCCOc1ccc(CC(Nc2ccccc2OC(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C33H38N2O6/c1-33(2,22-24-13-14-24)32(39)34-19-8-20-40-26-17-15-23(16-18-26)21-28(30(36)37)35-27-11-6-7-12-29(27)41-31(38)25-9-4-3-5-10-25/h3-7,9-12,15-18,24,28,35H,8,13-14,19-22H2,1-2H3,(H,34,39)(H,36,37) |
| InChIKey | WXPISCPUWAYDNW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|