C34H36N2O5 — CID 174522896
2-(2-benzoyloxyanilino)-4-[4-[3-[(3-methylphenyl)methylamino]propoxy]phenyl]butanoic acid (PubChem CID 174522896) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is 2-(2-benzoyloxyanilino)-4-[4-[3-[(3-methylphenyl)methylamino]propoxy]phenyl]butanoic acid.
| Compound Name | 2-(2-benzoyloxyanilino)-4-[4-[3-[(3-methylphenyl)methylamino]propoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 174522896 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 2-(2-benzoyloxyanilino)-4-[4-[3-[(3-methylphenyl)methylamino]propoxy]phenyl]butanoic acid |
| SMILES | Cc1cccc(CNCCCOc2ccc(CCC(Nc3ccccc3OC(=O)c3ccccc3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C34H36N2O5/c1-25-9-7-10-27(23-25)24-35-21-8-22-40-29-18-15-26(16-19-29)17-20-31(33(37)38)36-30-13-5-6-14-32(30)41-34(39)28-11-3-2-4-12-28/h2-7,9-16,18-19,23,31,35-36H,8,17,20-22,24H2,1H3,(H,37,38) |
| InChIKey | AIMISOUXLFJPPO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|