C33H34N2O5 — CID 175250262
2-(2-benzoyloxyanilino)-4-[4-[3-(benzylamino)propoxy]phenyl]butanoic acid (PubChem CID 175250262) has the molecular formula C33H34N2O5 and a molecular weight of 538.64 g/mol. Its IUPAC name is 2-(2-benzoyloxyanilino)-4-[4-[3-(benzylamino)propoxy]phenyl]butanoic acid.
| Compound Name | 2-(2-benzoyloxyanilino)-4-[4-[3-(benzylamino)propoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 175250262 |
| Molecular Formula | C33H34N2O5 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 2-(2-benzoyloxyanilino)-4-[4-[3-(benzylamino)propoxy]phenyl]butanoic acid |
| SMILES | O=C(Oc1ccccc1NC(CCc1ccc(OCCCNCc2ccccc2)cc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C33H34N2O5/c36-32(37)30(35-29-14-7-8-15-31(29)40-33(38)27-12-5-2-6-13-27)21-18-25-16-19-28(20-17-25)39-23-9-22-34-24-26-10-3-1-4-11-26/h1-8,10-17,19-20,30,34-35H,9,18,21-24H2,(H,36,37) |
| InChIKey | MPFQHXFHDURZKY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|