C37H40N2O5 — CID 69127034
2-(2-benzoylanilino)-3-[4-[2-[benzyl(3,3-dimethylbutanoyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 69127034) has the molecular formula C37H40N2O5 and a molecular weight of 592.74 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[2-[benzyl(3,3-dimethylbutanoyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[2-[benzyl(3,3-dimethylbutanoyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127034 |
| Molecular Formula | C37H40N2O5 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[2-[benzyl(3,3-dimethylbutanoyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CC(C)(C)CC(=O)N(CCOc1ccc(CC(Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C37H40N2O5/c1-37(2,3)25-34(40)39(26-28-12-6-4-7-13-28)22-23-44-30-20-18-27(19-21-30)24-33(36(42)43)38-32-17-11-10-16-31(32)35(41)29-14-8-5-9-15-29/h4-21,33,38H,22-26H2,1-3H3,(H,42,43) |
| InChIKey | CYMVIQUQYLEETH-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|