C31H36N2O5 — CID 69127288
2-(2-benzoylanilino)-3-[4-[2-[2,2-dimethylpropanoyl(ethyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 69127288) has the molecular formula C31H36N2O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[2-[2,2-dimethylpropanoyl(ethyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[2-[2,2-dimethylpropanoyl(ethyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127288 |
| Molecular Formula | C31H36N2O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[2-[2,2-dimethylpropanoyl(ethyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCN(CCOc1ccc(CC(Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C31H36N2O5/c1-5-33(30(37)31(2,3)4)19-20-38-24-17-15-22(16-18-24)21-27(29(35)36)32-26-14-10-9-13-25(26)28(34)23-11-7-6-8-12-23/h6-18,27,32H,5,19-21H2,1-4H3,(H,35,36) |
| InChIKey | VKKGVHNVRGQBAA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|