C32H29NO4 — CID 10505264
(2S)-2-(2-benzoylanilino)-3-[4-[(E)-2-methyl-3-phenylprop-2-enoxy]phenyl]propanoic acid (PubChem CID 10505264) has the molecular formula C32H29NO4 and a molecular weight of 491.59 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[(E)-2-methyl-3-phenylprop-2-enoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[(E)-2-methyl-3-phenylprop-2-enoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10505264 |
| Molecular Formula | C32H29NO4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[(E)-2-methyl-3-phenylprop-2-enoxy]phenyl]propanoic acid |
| SMILES | C/C(=C\c1ccccc1)COc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C32H29NO4/c1-23(20-24-10-4-2-5-11-24)22-37-27-18-16-25(17-19-27)21-30(32(35)36)33-29-15-9-8-14-28(29)31(34)26-12-6-3-7-13-26/h2-20,30,33H,21-22H2,1H3,(H,35,36)/b23-20+/t30-/m0/s1 |
| InChIKey | GCTMZTAMFFKOFD-CSFPYTDRSA-N |
| XLogP | 6.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|