C34H32N2O5 — CID 140501655
(2S)-2-(2-benzoylanilino)-3-[4-[2-[(4S,5S)-5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]ethoxy]phenyl]propanoic acid (PubChem CID 140501655) has the molecular formula C34H32N2O5 and a molecular weight of 548.64 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[2-[(4S,5S)-5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[(4S,5S)-5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 140501655 |
| Molecular Formula | C34H32N2O5 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[(4S,5S)-5-methyl-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]ethoxy]phenyl]propanoic acid |
| SMILES | C[C@@H]1OC(c2ccccc2)=N[C@H]1CCOc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C34H32N2O5/c1-23-29(36-33(41-23)26-12-6-3-7-13-26)20-21-40-27-18-16-24(17-19-27)22-31(34(38)39)35-30-15-9-8-14-28(30)32(37)25-10-4-2-5-11-25/h2-19,23,29,31,35H,20-22H2,1H3,(H,38,39)/t23-,29-,31-/m0/s1 |
| InChIKey | NOGXKTIGJGPJCF-MIOYRSISSA-N |
| XLogP | 6.03 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|