C40H35NO4 — CID 22048453
2-(2-benzoylanilino)-3-[4-[(2E)-2-(9H-fluoren-2-ylmethylidene)butoxy]phenyl]propanoic acid (PubChem CID 22048453) has the molecular formula C40H35NO4 and a molecular weight of 593.72 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[(2E)-2-(9H-fluoren-2-ylmethylidene)butoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[(2E)-2-(9H-fluoren-2-ylmethylidene)butoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22048453 |
| Molecular Formula | C40H35NO4 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[(2E)-2-(9H-fluoren-2-ylmethylidene)butoxy]phenyl]propanoic acid |
| SMILES | CC/C(=C\c1ccc2c(c1)Cc1ccccc1-2)COc1ccc(CC(Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C40H35NO4/c1-2-27(22-29-18-21-35-32(23-29)25-31-12-6-7-13-34(31)35)26-45-33-19-16-28(17-20-33)24-38(40(43)44)41-37-15-9-8-14-36(37)39(42)30-10-4-3-5-11-30/h3-23,38,41H,2,24-26H2,1H3,(H,43,44)/b27-22+ |
| InChIKey | UCIVCDUJZUYGFT-HPNDGRJYSA-N |
| XLogP | 8.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|