C36H36N2O6 — CID 174536420
[2-[[3-[2-[3-[benzyl(prop-2-enoyl)amino]propoxy]phenoxy]-2-methyl-3-oxopropyl]amino]phenyl] benzoate (PubChem CID 174536420) has the molecular formula C36H36N2O6 and a molecular weight of 592.69 g/mol. Its IUPAC name is [2-[[3-[2-[3-[benzyl(prop-2-enoyl)amino]propoxy]phenoxy]-2-methyl-3-oxopropyl]amino]phenyl] benzoate.
| Compound Name | [2-[[3-[2-[3-[benzyl(prop-2-enoyl)amino]propoxy]phenoxy]-2-methyl-3-oxopropyl]amino]phenyl] benzoate |
|---|---|
| PubChem CID | 174536420 |
| Molecular Formula | C36H36N2O6 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | [2-[[3-[2-[3-[benzyl(prop-2-enoyl)amino]propoxy]phenoxy]-2-methyl-3-oxopropyl]amino]phenyl] benzoate |
| SMILES | C=CC(=O)N(CCCOc1ccccc1OC(=O)C(C)CNc1ccccc1OC(=O)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C36H36N2O6/c1-3-34(39)38(26-28-15-6-4-7-16-28)23-14-24-42-32-21-12-13-22-33(32)44-35(40)27(2)25-37-30-19-10-11-20-31(30)43-36(41)29-17-8-5-9-18-29/h3-13,15-22,27,37H,1,14,23-26H2,2H3 |
| InChIKey | FXOZRSHZBWJEOL-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|