C37H38N2O5 — CID 90718965
methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(but-2-enoyl)amino]propoxy]phenyl]propanoate (PubChem CID 90718965) has the molecular formula C37H38N2O5 and a molecular weight of 590.72 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(but-2-enoyl)amino]propoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(but-2-enoyl)amino]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 90718965 |
| Molecular Formula | C37H38N2O5 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(but-2-enoyl)amino]propoxy]phenyl]propanoate |
| SMILES | CC=CC(=O)N(CCCOc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)OC)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C37H38N2O5/c1-3-13-35(40)39(27-29-14-6-4-7-15-29)24-12-25-44-31-22-20-28(21-23-31)26-34(37(42)43-2)38-33-19-11-10-18-32(33)36(41)30-16-8-5-9-17-30/h3-11,13-23,34,38H,12,24-27H2,1-2H3/t34-/m0/s1 |
| InChIKey | CFXSQBSKNKWYBM-UMSFTDKQSA-N |
| XLogP | 6.49 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|