C39H40N2O5 — CID 69127929
methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[cyclopropylmethyl-[(E)-3-phenylprop-2-enoyl]amino]propoxy]phenyl]propanoate (PubChem CID 69127929) has the molecular formula C39H40N2O5 and a molecular weight of 616.76 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[cyclopropylmethyl-[(E)-3-phenylprop-2-enoyl]amino]propoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[cyclopropylmethyl-[(E)-3-phenylprop-2-enoyl]amino]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69127929 |
| Molecular Formula | C39H40N2O5 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[cyclopropylmethyl-[(E)-3-phenylprop-2-enoyl]amino]propoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCCN(CC2CC2)C(=O)/C=C/c2ccccc2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C39H40N2O5/c1-45-39(44)36(40-35-16-9-8-15-34(35)38(43)32-13-6-3-7-14-32)27-30-19-22-33(23-20-30)46-26-10-25-41(28-31-17-18-31)37(42)24-21-29-11-4-2-5-12-29/h2-9,11-16,19-24,31,36,40H,10,17-18,25-28H2,1H3/b24-21+/t36-/m0/s1 |
| InChIKey | CMEUHXLDLMYRTG-ZYRVCXHZSA-N |
| XLogP | 6.83 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|