C39H36N2O6 — CID 69143103
methyl 2-(2-benzoylanilino)-3-[4-[3-[N-[3-(furan-2-yl)prop-2-enoyl]anilino]propoxy]phenyl]propanoate (PubChem CID 69143103) has the molecular formula C39H36N2O6 and a molecular weight of 628.73 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[3-[N-[3-(furan-2-yl)prop-2-enoyl]anilino]propoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[3-[N-[3-(furan-2-yl)prop-2-enoyl]anilino]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69143103 |
| Molecular Formula | C39H36N2O6 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[3-[N-[3-(furan-2-yl)prop-2-enoyl]anilino]propoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCCN(C(=O)C=Cc2ccco2)c2ccccc2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C39H36N2O6/c1-45-39(44)36(40-35-18-9-8-17-34(35)38(43)30-12-4-2-5-13-30)28-29-19-21-33(22-20-29)47-27-11-25-41(31-14-6-3-7-15-31)37(42)24-23-32-16-10-26-46-32/h2-10,12-24,26,36,40H,11,25,27-28H2,1H3 |
| InChIKey | WEZOGJNNBDRMFK-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|