C38H34N2O5S — CID 69127580
methyl 2-(2-benzoylanilino)-3-[4-[2-[N-(3-thiophen-3-ylprop-2-enoyl)anilino]ethoxy]phenyl]propanoate (PubChem CID 69127580) has the molecular formula C38H34N2O5S and a molecular weight of 630.77 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[2-[N-(3-thiophen-3-ylprop-2-enoyl)anilino]ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[2-[N-(3-thiophen-3-ylprop-2-enoyl)anilino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69127580 |
| Molecular Formula | C38H34N2O5S |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[2-[N-(3-thiophen-3-ylprop-2-enoyl)anilino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCN(C(=O)C=Cc2ccsc2)c2ccccc2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C38H34N2O5S/c1-44-38(43)35(39-34-15-9-8-14-33(34)37(42)30-10-4-2-5-11-30)26-28-16-19-32(20-17-28)45-24-23-40(31-12-6-3-7-13-31)36(41)21-18-29-22-25-46-27-29/h2-22,25,27,35,39H,23-24,26H2,1H3 |
| InChIKey | HMHWRGSMSJFCSZ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|