C37H32N2O5S — CID 69127825
(2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(3-thiophen-3-ylprop-2-enoyl)anilino]ethoxy]phenyl]propanoic acid (PubChem CID 69127825) has the molecular formula C37H32N2O5S and a molecular weight of 616.74 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(3-thiophen-3-ylprop-2-enoyl)anilino]ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(3-thiophen-3-ylprop-2-enoyl)anilino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127825 |
| Molecular Formula | C37H32N2O5S |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(3-thiophen-3-ylprop-2-enoyl)anilino]ethoxy]phenyl]propanoic acid |
| SMILES | O=C(c1ccccc1)c1ccccc1N[C@@H](Cc1ccc(OCCN(C(=O)C=Cc2ccsc2)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C37H32N2O5S/c40-35(20-17-28-21-24-45-26-28)39(30-11-5-2-6-12-30)22-23-44-31-18-15-27(16-19-31)25-34(37(42)43)38-33-14-8-7-13-32(33)36(41)29-9-3-1-4-10-29/h1-21,24,26,34,38H,22-23,25H2,(H,42,43)/t34-/m0/s1 |
| InChIKey | QCPQGYFHRLNBIT-UMSFTDKQSA-N |
| XLogP | 7.21 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|