C39H35N3O5 — CID 69126531
(2S)-2-(2-benzoylanilino)-3-[4-[3-[N-(3-pyridin-3-ylprop-2-enoyl)anilino]propoxy]phenyl]propanoic acid (PubChem CID 69126531) has the molecular formula C39H35N3O5 and a molecular weight of 625.73 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[3-[N-(3-pyridin-3-ylprop-2-enoyl)anilino]propoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[N-(3-pyridin-3-ylprop-2-enoyl)anilino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69126531 |
| Molecular Formula | C39H35N3O5 |
| Molecular Weight | 625.73 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[N-(3-pyridin-3-ylprop-2-enoyl)anilino]propoxy]phenyl]propanoic acid |
| SMILES | O=C(c1ccccc1)c1ccccc1N[C@@H](Cc1ccc(OCCCN(C(=O)C=Cc2cccnc2)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C39H35N3O5/c43-37(23-20-30-11-9-24-40-28-30)42(32-14-5-2-6-15-32)25-10-26-47-33-21-18-29(19-22-33)27-36(39(45)46)41-35-17-8-7-16-34(35)38(44)31-12-3-1-4-13-31/h1-9,11-24,28,36,41H,10,25-27H2,(H,45,46)/t36-/m0/s1 |
| InChIKey | OQZFGBURXNXIPF-BHVANESWSA-N |
| XLogP | 6.94 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.73 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|