C37H34N4O5 — CID 69127650
(2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(pyrazine-2-carbonyl)amino]propoxy]phenyl]propanoic acid (PubChem CID 69127650) has the molecular formula C37H34N4O5 and a molecular weight of 614.70 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(pyrazine-2-carbonyl)amino]propoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(pyrazine-2-carbonyl)amino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127650 |
| Molecular Formula | C37H34N4O5 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(pyrazine-2-carbonyl)amino]propoxy]phenyl]propanoic acid |
| SMILES | O=C(c1ccccc1)c1ccccc1N[C@@H](Cc1ccc(OCCCN(Cc2ccccc2)C(=O)c2cnccn2)cc1)C(=O)O |
| InChI | InChI=1S/C37H34N4O5/c42-35(29-12-5-2-6-13-29)31-14-7-8-15-32(31)40-33(37(44)45)24-27-16-18-30(19-17-27)46-23-9-22-41(26-28-10-3-1-4-11-28)36(43)34-25-38-20-21-39-34/h1-8,10-21,25,33,40H,9,22-24,26H2,(H,44,45)/t33-/m0/s1 |
| InChIKey | NDDHQMSVMKNHNT-XIFFEERXSA-N |
| XLogP | 5.93 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|