C42H38N2O5 — CID 69125875
methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(3-phenylprop-2-ynoyl)amino]propoxy]phenyl]propanoate (PubChem CID 69125875) has the molecular formula C42H38N2O5 and a molecular weight of 650.78 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(3-phenylprop-2-ynoyl)amino]propoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(3-phenylprop-2-ynoyl)amino]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69125875 |
| Molecular Formula | C42H38N2O5 |
| Molecular Weight | 650.78 g/mol |
| Exact Mass | 650.28 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(3-phenylprop-2-ynoyl)amino]propoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCCN(Cc2ccccc2)C(=O)C#Cc2ccccc2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C42H38N2O5/c1-48-42(47)39(43-38-21-12-11-20-37(38)41(46)35-18-9-4-10-19-35)30-33-22-25-36(26-23-33)49-29-13-28-44(31-34-16-7-3-8-17-34)40(45)27-24-32-14-5-2-6-15-32/h2-12,14-23,25-26,39,43H,13,28-31H2,1H3/t39-/m0/s1 |
| InChIKey | MAIFKNRNHAMLDU-KDXMTYKHSA-N |
| XLogP | 6.96 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.78 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|