C34H34N2O5S — CID 69127370
methyl 2-(2-benzoylanilino)-3-[4-[2-[cyclopropylmethyl(thiophene-2-carbonyl)amino]ethoxy]phenyl]propanoate (PubChem CID 69127370) has the molecular formula C34H34N2O5S and a molecular weight of 582.72 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[2-[cyclopropylmethyl(thiophene-2-carbonyl)amino]ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[2-[cyclopropylmethyl(thiophene-2-carbonyl)amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69127370 |
| Molecular Formula | C34H34N2O5S |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[2-[cyclopropylmethyl(thiophene-2-carbonyl)amino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCN(CC2CC2)C(=O)c2cccs2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C34H34N2O5S/c1-40-34(39)30(35-29-11-6-5-10-28(29)32(37)26-8-3-2-4-9-26)22-24-15-17-27(18-16-24)41-20-19-36(23-25-13-14-25)33(38)31-12-7-21-42-31/h2-12,15-18,21,25,30,35H,13-14,19-20,22-23H2,1H3 |
| InChIKey | JENSMGAPVMAEDE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|