C37H33N3O4 — CID 68643248
(2S)-2-(2-benzoylanilino)-3-[4-[3-[benzylcarbamoyl(methyl)amino]phenyl]phenyl]propanoic acid (PubChem CID 68643248) has the molecular formula C37H33N3O4 and a molecular weight of 583.69 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzylcarbamoyl(methyl)amino]phenyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzylcarbamoyl(methyl)amino]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 68643248 |
| Molecular Formula | C37H33N3O4 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzylcarbamoyl(methyl)amino]phenyl]phenyl]propanoic acid |
| SMILES | CN(C(=O)NCc1ccccc1)c1cccc(-c2ccc(C[C@H](Nc3ccccc3C(=O)c3ccccc3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C37H33N3O4/c1-40(37(44)38-25-27-11-4-2-5-12-27)31-16-10-15-30(24-31)28-21-19-26(20-22-28)23-34(36(42)43)39-33-18-9-8-17-32(33)35(41)29-13-6-3-7-14-29/h2-22,24,34,39H,23,25H2,1H3,(H,38,44)(H,42,43)/t34-/m0/s1 |
| InChIKey | YXLLMWVNUCYMQB-UMSFTDKQSA-N |
| XLogP | 7.04 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|