C38H42N2O4 — CID 77490608
2-(2-benzoylanilino)-3-[4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoic acid (PubChem CID 77490608) has the molecular formula C38H42N2O4 and a molecular weight of 590.76 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 77490608 |
| Molecular Formula | C38H42N2O4 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoic acid |
| SMILES | CCCCCCCC(=O)N(C)Cc1cccc(-c2ccc(CC(Nc3ccccc3C(=O)c3ccccc3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C38H42N2O4/c1-3-4-5-6-10-20-36(41)40(2)27-29-14-13-17-32(25-29)30-23-21-28(22-24-30)26-35(38(43)44)39-34-19-12-11-18-33(34)37(42)31-15-8-7-9-16-31/h7-9,11-19,21-25,35,39H,3-6,10,20,26-27H2,1-2H3,(H,43,44) |
| InChIKey | WBNRJMAKCCYIFL-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|