C34H36N2O4S — CID 67320414
(2S)-2-(2-benzoylanilino)-3-[4-[5-[(2-oxoheptylamino)methyl]thiophen-3-yl]phenyl]propanoic acid (PubChem CID 67320414) has the molecular formula C34H36N2O4S and a molecular weight of 568.74 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[5-[(2-oxoheptylamino)methyl]thiophen-3-yl]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[5-[(2-oxoheptylamino)methyl]thiophen-3-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67320414 |
| Molecular Formula | C34H36N2O4S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[5-[(2-oxoheptylamino)methyl]thiophen-3-yl]phenyl]propanoic acid |
| SMILES | CCCCCC(=O)CNCc1cc(-c2ccc(C[C@H](Nc3ccccc3C(=O)c3ccccc3)C(=O)O)cc2)cs1 |
| InChI | InChI=1S/C34H36N2O4S/c1-2-3-5-12-28(37)21-35-22-29-20-27(23-41-29)25-17-15-24(16-18-25)19-32(34(39)40)36-31-14-9-8-13-30(31)33(38)26-10-6-4-7-11-26/h4,6-11,13-18,20,23,32,35-36H,2-3,5,12,19,21-22H2,1H3,(H,39,40)/t32-/m0/s1 |
| InChIKey | ZUFWBKCMVVOOHB-YTTGMZPUSA-N |
| XLogP | 6.99 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|