C22H30N2O3S — CID 67148011
(2S)-3-[4-[5-[[hexanoyl(methyl)amino]methyl]thiophen-3-yl]phenyl]-2-(methylamino)propanoic acid (PubChem CID 67148011) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is (2S)-3-[4-[5-[[hexanoyl(methyl)amino]methyl]thiophen-3-yl]phenyl]-2-(methylamino)propanoic acid.
| Compound Name | (2S)-3-[4-[5-[[hexanoyl(methyl)amino]methyl]thiophen-3-yl]phenyl]-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 67148011 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (2S)-3-[4-[5-[[hexanoyl(methyl)amino]methyl]thiophen-3-yl]phenyl]-2-(methylamino)propanoic acid |
| SMILES | CCCCCC(=O)N(C)Cc1cc(-c2ccc(C[C@H](NC)C(=O)O)cc2)cs1 |
| InChI | InChI=1S/C22H30N2O3S/c1-4-5-6-7-21(25)24(3)14-19-13-18(15-28-19)17-10-8-16(9-11-17)12-20(23-2)22(26)27/h8-11,13,15,20,23H,4-7,12,14H2,1-3H3,(H,26,27)/t20-/m0/s1 |
| InChIKey | GZCIZIBIGCJREB-FQEVSTJZSA-N |
| XLogP | 4.17 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|