C21H27NO4S — CID 67147844
(2S)-3-[4-[5-[[butanoyl(methyl)amino]methyl]thiophen-3-yl]phenyl]-2-ethoxypropanoic acid (PubChem CID 67147844) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is (2S)-3-[4-[5-[[butanoyl(methyl)amino]methyl]thiophen-3-yl]phenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[4-[5-[[butanoyl(methyl)amino]methyl]thiophen-3-yl]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 67147844 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (2S)-3-[4-[5-[[butanoyl(methyl)amino]methyl]thiophen-3-yl]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCC(=O)N(C)Cc1cc(-c2ccc(C[C@H](OCC)C(=O)O)cc2)cs1 |
| InChI | InChI=1S/C21H27NO4S/c1-4-6-20(23)22(3)13-18-12-17(14-27-18)16-9-7-15(8-10-16)11-19(21(24)25)26-5-2/h7-10,12,14,19H,4-6,11,13H2,1-3H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | YDZBPRAFOGLZHR-IBGZPJMESA-N |
| XLogP | 4.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |