C25H35NO5 — CID 67147787
(2S)-2-ethoxy-3-[4-[5-[[methyl(octanoyl)amino]methyl]furan-2-yl]phenyl]propanoic acid (PubChem CID 67147787) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[4-[5-[[methyl(octanoyl)amino]methyl]furan-2-yl]phenyl]propanoic acid.
| Compound Name | (2S)-2-ethoxy-3-[4-[5-[[methyl(octanoyl)amino]methyl]furan-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67147787 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | (2S)-2-ethoxy-3-[4-[5-[[methyl(octanoyl)amino]methyl]furan-2-yl]phenyl]propanoic acid |
| SMILES | CCCCCCCC(=O)N(C)Cc1ccc(-c2ccc(C[C@H](OCC)C(=O)O)cc2)o1 |
| InChI | InChI=1S/C25H35NO5/c1-4-6-7-8-9-10-24(27)26(3)18-21-15-16-22(31-21)20-13-11-19(12-14-20)17-23(25(28)29)30-5-2/h11-16,23H,4-10,17-18H2,1-3H3,(H,28,29)/t23-/m0/s1 |
| InChIKey | RPTWKPQCFRBBSI-QHCPKHFHSA-N |
| XLogP | 5.30 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|