C20H31NO5 — CID 22231555
2-ethoxy-3-[4-[2-(heptanoylamino)ethoxy]phenyl]propanoic acid (PubChem CID 22231555) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-(heptanoylamino)ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-(heptanoylamino)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231555 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 2-ethoxy-3-[4-[2-(heptanoylamino)ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCCC(=O)NCCOc1ccc(CC(OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C20H31NO5/c1-3-5-6-7-8-19(22)21-13-14-26-17-11-9-16(10-12-17)15-18(20(23)24)25-4-2/h9-12,18H,3-8,13-15H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | OYUMRGOUDNYPDN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|