C29H41NO4 — CID 10276770
(2R)-2-ethoxy-3-[4-[2-[heptyl-[2-(4-methylphenyl)acetyl]amino]ethyl]phenyl]propanoic acid (PubChem CID 10276770) has the molecular formula C29H41NO4 and a molecular weight of 467.65 g/mol. Its IUPAC name is (2R)-2-ethoxy-3-[4-[2-[heptyl-[2-(4-methylphenyl)acetyl]amino]ethyl]phenyl]propanoic acid.
| Compound Name | (2R)-2-ethoxy-3-[4-[2-[heptyl-[2-(4-methylphenyl)acetyl]amino]ethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10276770 |
| Molecular Formula | C29H41NO4 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | (2R)-2-ethoxy-3-[4-[2-[heptyl-[2-(4-methylphenyl)acetyl]amino]ethyl]phenyl]propanoic acid |
| SMILES | CCCCCCCN(CCc1ccc(C[C@@H](OCC)C(=O)O)cc1)C(=O)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C29H41NO4/c1-4-6-7-8-9-19-30(28(31)22-26-12-10-23(3)11-13-26)20-18-24-14-16-25(17-15-24)21-27(29(32)33)34-5-2/h10-17,27H,4-9,18-22H2,1-3H3,(H,32,33)/t27-/m1/s1 |
| InChIKey | HVPGUOUVENYJGJ-HHHXNRCGSA-N |
| XLogP | 5.61 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|