C29H39F2NO5 — CID 11466514
(2S)-3-[4-[2-[(2,4-difluorophenyl)methyl-nonylamino]-2-oxoethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 11466514) has the molecular formula C29H39F2NO5 and a molecular weight of 519.63 g/mol. Its IUPAC name is (2S)-3-[4-[2-[(2,4-difluorophenyl)methyl-nonylamino]-2-oxoethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[4-[2-[(2,4-difluorophenyl)methyl-nonylamino]-2-oxoethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 11466514 |
| Molecular Formula | C29H39F2NO5 |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | (2S)-3-[4-[2-[(2,4-difluorophenyl)methyl-nonylamino]-2-oxoethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCCCCCCN(Cc1ccc(F)cc1F)C(=O)COc1ccc(C[C@H](OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C29H39F2NO5/c1-3-5-6-7-8-9-10-17-32(20-23-13-14-24(30)19-26(23)31)28(33)21-37-25-15-11-22(12-16-25)18-27(29(34)35)36-4-2/h11-16,19,27H,3-10,17-18,20-21H2,1-2H3,(H,34,35)/t27-/m0/s1 |
| InChIKey | QRUWUDBPVPMOFQ-MHZLTWQESA-N |
| XLogP | 6.16 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|