C23H31NO3S — CID 11553138
3-[4-[5-[[methyl(octanoyl)amino]methyl]thiophen-3-yl]phenyl]propanoic acid (PubChem CID 11553138) has the molecular formula C23H31NO3S and a molecular weight of 401.57 g/mol. Its IUPAC name is 3-[4-[5-[[methyl(octanoyl)amino]methyl]thiophen-3-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[5-[[methyl(octanoyl)amino]methyl]thiophen-3-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11553138 |
| Molecular Formula | C23H31NO3S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 3-[4-[5-[[methyl(octanoyl)amino]methyl]thiophen-3-yl]phenyl]propanoic acid |
| SMILES | CCCCCCCC(=O)N(C)Cc1cc(-c2ccc(CCC(=O)O)cc2)cs1 |
| InChI | InChI=1S/C23H31NO3S/c1-3-4-5-6-7-8-22(25)24(2)16-21-15-20(17-28-21)19-12-9-18(10-13-19)11-14-23(26)27/h9-10,12-13,15,17H,3-8,11,14,16H2,1-2H3,(H,26,27) |
| InChIKey | QZZYZVJCYGXUNT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|