C25H32FNO3 — CID 11718581
3-[2-fluoro-4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoic acid (PubChem CID 11718581) has the molecular formula C25H32FNO3 and a molecular weight of 413.53 g/mol. Its IUPAC name is 3-[2-fluoro-4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoic acid.
| Compound Name | 3-[2-fluoro-4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11718581 |
| Molecular Formula | C25H32FNO3 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 3-[2-fluoro-4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoic acid |
| SMILES | CCCCCCCC(=O)N(C)Cc1cccc(-c2ccc(CCC(=O)O)c(F)c2)c1 |
| InChI | InChI=1S/C25H32FNO3/c1-3-4-5-6-7-11-24(28)27(2)18-19-9-8-10-21(16-19)22-13-12-20(23(26)17-22)14-15-25(29)30/h8-10,12-13,16-17H,3-7,11,14-15,18H2,1-2H3,(H,29,30) |
| InChIKey | WFGSVRFGHKFHFQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|