C31H46N2O4 — CID 11511822
3-[3-[2-(diethylamino)ethoxy]-4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoic acid (PubChem CID 11511822) has the molecular formula C31H46N2O4 and a molecular weight of 510.72 g/mol. Its IUPAC name is 3-[3-[2-(diethylamino)ethoxy]-4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[2-(diethylamino)ethoxy]-4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11511822 |
| Molecular Formula | C31H46N2O4 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | 3-[3-[2-(diethylamino)ethoxy]-4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoic acid |
| SMILES | CCCCCCCC(=O)N(C)Cc1cccc(-c2ccc(CCC(=O)O)cc2OCCN(CC)CC)c1 |
| InChI | InChI=1S/C31H46N2O4/c1-5-8-9-10-11-15-30(34)32(4)24-26-13-12-14-27(22-26)28-18-16-25(17-19-31(35)36)23-29(28)37-21-20-33(6-2)7-3/h12-14,16,18,22-23H,5-11,15,17,19-21,24H2,1-4H3,(H,35,36) |
| InChIKey | AZAYCITYYOEUEK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|