C27H38N2O3 — CID 11568347
3-[3-(butylamino)-4-[3-[[hexanoyl(methyl)amino]methyl]phenyl]phenyl]propanoic acid (PubChem CID 11568347) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is 3-[3-(butylamino)-4-[3-[[hexanoyl(methyl)amino]methyl]phenyl]phenyl]propanoic acid.
| Compound Name | 3-[3-(butylamino)-4-[3-[[hexanoyl(methyl)amino]methyl]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11568347 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 3-[3-(butylamino)-4-[3-[[hexanoyl(methyl)amino]methyl]phenyl]phenyl]propanoic acid |
| SMILES | CCCCCC(=O)N(C)Cc1cccc(-c2ccc(CCC(=O)O)cc2NCCCC)c1 |
| InChI | InChI=1S/C27H38N2O3/c1-4-6-8-12-26(30)29(3)20-22-10-9-11-23(18-22)24-15-13-21(14-16-27(31)32)19-25(24)28-17-7-5-2/h9-11,13,15,18-19,28H,4-8,12,14,16-17,20H2,1-3H3,(H,31,32) |
| InChIKey | LPWRZFKOYAKKMW-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|