C30H43NO4 — CID 69261117
methyl 3-[3-butoxy-4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoate (PubChem CID 69261117) has the molecular formula C30H43NO4 and a molecular weight of 481.68 g/mol. Its IUPAC name is methyl 3-[3-butoxy-4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoate.
| Compound Name | methyl 3-[3-butoxy-4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 69261117 |
| Molecular Formula | C30H43NO4 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | methyl 3-[3-butoxy-4-[3-[[methyl(octanoyl)amino]methyl]phenyl]phenyl]propanoate |
| SMILES | CCCCCCCC(=O)N(C)Cc1cccc(-c2ccc(CCC(=O)OC)cc2OCCCC)c1 |
| InChI | InChI=1S/C30H43NO4/c1-5-7-9-10-11-15-29(32)31(3)23-25-13-12-14-26(21-25)27-18-16-24(17-19-30(33)34-4)22-28(27)35-20-8-6-2/h12-14,16,18,21-22H,5-11,15,17,19-20,23H2,1-4H3 |
| InChIKey | BYSWOTMHEWQZOE-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|