C29H43N3O3 — CID 67272270
methyl 3-[3-(butylamino)-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoate (PubChem CID 67272270) has the molecular formula C29H43N3O3 and a molecular weight of 481.68 g/mol. Its IUPAC name is methyl 3-[3-(butylamino)-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoate.
| Compound Name | methyl 3-[3-(butylamino)-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 67272270 |
| Molecular Formula | C29H43N3O3 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | methyl 3-[3-(butylamino)-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoate |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(CCC(=O)OC)cc2NCCCC)c1 |
| InChI | InChI=1S/C29H43N3O3/c1-5-7-9-10-11-20-31-29(34)32(3)25-14-12-13-24(22-25)26-17-15-23(16-18-28(33)35-4)21-27(26)30-19-8-6-2/h12-15,17,21-22,30H,5-11,16,18-20H2,1-4H3,(H,31,34) |
| InChIKey | RLXLXODFZUISDY-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|