C31H44N2O4 — CID 11620421
3-[3-(cyclohexylmethoxy)-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoic acid (PubChem CID 11620421) has the molecular formula C31H44N2O4 and a molecular weight of 508.70 g/mol. Its IUPAC name is 3-[3-(cyclohexylmethoxy)-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoic acid.
| Compound Name | 3-[3-(cyclohexylmethoxy)-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11620421 |
| Molecular Formula | C31H44N2O4 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | 3-[3-(cyclohexylmethoxy)-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(CCC(=O)O)cc2OCC2CCCCC2)c1 |
| InChI | InChI=1S/C31H44N2O4/c1-3-4-5-6-10-20-32-31(36)33(2)27-15-11-14-26(22-27)28-18-16-24(17-19-30(34)35)21-29(28)37-23-25-12-8-7-9-13-25/h11,14-16,18,21-22,25H,3-10,12-13,17,19-20,23H2,1-2H3,(H,32,36)(H,34,35) |
| InChIKey | IHGFQQWGBWZCTK-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|